Compound Q&A

How is Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) typically synthesized?

Answer

Pentadecafluorooctanoic acid ammoniate (1:1)
Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) is typically synthesized through the reaction of pentadecafluorooctanoic acid with ammonium hydroxide. The synthesis process involves careful temperature and pH control to achieve the desired stoichiometry of the ammoniate salt.

About

CAS No 3825-26-1
English Name Pentadecafluorooctanoic acid ammoniate (1:1)
Molecular Formula C8H4F15NO2
Molecular Weight 431.09 g/mol
SMILES C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[NH4+]
InChIKey YOALFLHFSFEMLP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1)?

Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) is a white crystalline solid with a hi...

Compound Q&A

What industries use Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1)?

Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) finds applications in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1)?

When handling Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1), wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...