Compound Q&A

What industries use Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1)?

Answer

Pentadecafluorooctanoic acid ammoniate (1:1)
Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) finds applications in the pharmaceutical industry for the production of certain medicinals, in polymer science for enhancing material properties, and in the sensors and semiconductors industry for its unique electronic and thermal properties.

About

CAS No 3825-26-1
English Name Pentadecafluorooctanoic acid ammoniate (1:1)
Molecular Formula C8H4F15NO2
Molecular Weight 431.09 g/mol
SMILES C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[NH4+]
InChIKey YOALFLHFSFEMLP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1)?

Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) is a white crystalline solid with a hi...

Compound Q&A

How is Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) typically synthesized?

Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1) is typically synthesized through the r...

Compound Q&A

What precautions should be taken when handling Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1)?

When handling Pentadecafluorooctanoic acid ammoniate (1:1) (CAS: 3825-26-1), wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...