Compound Q&A

What industries use 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8)?

Answer

2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate
2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8) is used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in polymer synthesis to improve the properties of polymers. Additionally, it plays a role in the production of sensors and semiconductors due to its chemical reactivity and functionality.

About

CAS No 71432-55-8
English Name 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate
Molecular Formula C11H24N2O
Molecular Weight 200.32599999999996 g/mol
SMILES CC(C)NC(=NC(C)C)OC(C)(C)C
InChIKey FESDUDPSRMWIDL-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8)?

2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8) is a solid with a crystalline fo...

Compound Q&A

How is 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8) typically synthesized?

2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate is typically synthesized via the reaction of diiso...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8)?

When handling 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8), it is essential t...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...