Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8)?

Answer

2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate
2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8) is a solid with a crystalline form. It has a molecular weight of approximately 317.44 g/mol. The compound is slightly soluble in water but has good solubility in organic solvents like ethanol and acetone. It is moderately reactive and can undergo hydrolysis under basic conditions. This compound is used in various chemical reactions due to its reactivity.

About

CAS No 71432-55-8
English Name 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate
Molecular Formula C11H24N2O
Molecular Weight 200.33 g/mol
SMILES CC(C)NC(=NC(C)C)OC(C)(C)C
InChIKey FESDUDPSRMWIDL-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8) typically synthesized?

2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate is typically synthesized via the reaction of diiso...

Compound Q&A

What industries use 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8)?

2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8) is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8)?

When handling 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...