Compound Q&A

How is 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8) typically synthesized?

Answer

2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate
2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate is typically synthesized via the reaction of diisopropyl carbodiimide and 2-methyl-2-propanamine. The synthesis involves a multi-step process that includes the formation of an intermediate imidate ester, followed by its reaction with diisopropylamine. The yield is generally high, and the reaction can be catalyzed with small amounts of Lewis acids to improve selectivity.

About

CAS No 71432-55-8
English Name 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate
Molecular Formula C11H24N2O
Molecular Weight 200.32599999999996 g/mol
SMILES CC(C)NC(=NC(C)C)OC(C)(C)C
InChIKey FESDUDPSRMWIDL-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8)?

2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8) is a solid with a crystalline fo...

Compound Q&A

What industries use 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8)?

2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8) is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8)?

When handling 2-Methyl-2-propanyl N,N'-diisopropylcarbamimidate (CAS: 71432-55-8), it is essential t...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...