Compound Q&A

What precautions should be taken when handling Hydroxyethyl photolinker (CAS: 175281-76-2)?

Answer

Hydroxyethyl photolinker
When handling Hydroxyethyl photolinker (CAS 175281-76-2), it is essential to wear personal protective equipment (PPE) such as gloves and safety goggles. Work should be conducted in a well-ventilated area or a fume hood to avoid inhalation. Spills should be cleaned up immediately using a suitable absorbent material. Always consult the safety data sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name Hydroxyethyl photolinker
Molecular Formula C13H17NO7
Molecular Weight 299.28 g/mol
SMILES CC(C1=CC(=C(C=C1[N+](=O)[O-])OCCCC(=O)O)OC)O
InChIKey DUIJUTBRRZCWRD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hydroxyethyl photolinker (CAS: 175281-76-2)?

Hydroxyethyl photolinker (CAS 175281-76-2) is a water-soluble compound with a molecular weight of ap...

Compound Q&A

How is Hydroxyethyl photolinker (CAS: 175281-76-2) typically synthesized?

Hydroxyethyl photolinker can be synthesized through the reaction of hydroxyethyl chloride with sodiu...

Compound Q&A

What industries use Hydroxyethyl photolinker (CAS: 175281-76-2)?

Hydroxyethyl photolinker (CAS 175281-76-2) is primarily used in the pharmaceutical industry for drug...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...