Compound Q&A

What industries use Hydroxyethyl photolinker (CAS: 175281-76-2)?

Answer

Hydroxyethyl photolinker
Hydroxyethyl photolinker (CAS 175281-76-2) is primarily used in the pharmaceutical industry for drug delivery systems, in the polymer industry for photopolymerizable materials, in the sensor industry for developing photoresponsive sensors, and in the semiconductor industry for creating photoresists and patterning techniques.

About

English Name Hydroxyethyl photolinker
Molecular Formula C13H17NO7
Molecular Weight 299.28 g/mol
SMILES CC(C1=CC(=C(C=C1[N+](=O)[O-])OCCCC(=O)O)OC)O
InChIKey DUIJUTBRRZCWRD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hydroxyethyl photolinker (CAS: 175281-76-2)?

Hydroxyethyl photolinker (CAS 175281-76-2) is a water-soluble compound with a molecular weight of ap...

Compound Q&A

How is Hydroxyethyl photolinker (CAS: 175281-76-2) typically synthesized?

Hydroxyethyl photolinker can be synthesized through the reaction of hydroxyethyl chloride with sodiu...

Compound Q&A

What precautions should be taken when handling Hydroxyethyl photolinker (CAS: 175281-76-2)?

When handling Hydroxyethyl photolinker (CAS 175281-76-2), it is essential to wear personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...