Compound Q&A

What are the physical and chemical properties of Hydroxyethyl photolinker (CAS: 175281-76-2)?

Answer

Hydroxyethyl photolinker
Hydroxyethyl photolinker (CAS 175281-76-2) is a water-soluble compound with a molecular weight of approximately 110.14 g/mol. It crystallizes in the form of white to off-white crystals. The compound is moderately soluble in water and ethanol but has low solubility in lipophilic solvents. It exhibits high reactivity under UV light, which makes it useful for photopolymerization reactions.

About

English Name Hydroxyethyl photolinker
Molecular Formula C13H17NO7
Molecular Weight 299.28 g/mol
SMILES CC(C1=CC(=C(C=C1[N+](=O)[O-])OCCCC(=O)O)OC)O
InChIKey DUIJUTBRRZCWRD-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Hydroxyethyl photolinker (CAS: 175281-76-2) typically synthesized?

Hydroxyethyl photolinker can be synthesized through the reaction of hydroxyethyl chloride with sodiu...

Compound Q&A

What industries use Hydroxyethyl photolinker (CAS: 175281-76-2)?

Hydroxyethyl photolinker (CAS 175281-76-2) is primarily used in the pharmaceutical industry for drug...

Compound Q&A

What precautions should be taken when handling Hydroxyethyl photolinker (CAS: 175281-76-2)?

When handling Hydroxyethyl photolinker (CAS 175281-76-2), it is essential to wear personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...