Compound Q&A

What industries use m-PEG4-NHS ester (CAS: 622405-78-1)?

Answer

m-PEG4-NHS ester
m-PEG4-NHS ester (CAS: 622405-78-1) is widely used in pharmaceuticals for drug conjugation and drug delivery systems. It is also used in polymer chemistry for polymer modification, in biosensors for immobilizing biomolecules, and in semiconductor industry for surface functionalization.

About

English Name m-PEG4-NHS ester
Molecular Formula C14H23NO8
Molecular Weight 333.34 g/mol
SMILES COCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O
InChIKey MAYFFZZPEREGBQ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of m-PEG4-NHS ester (CAS: 622405-78-1)?

m-PEG4-NHS ester (CAS: 622405-78-1) is a water-soluble compound with a molecular weight of approxima...

Compound Q&A

How is m-PEG4-NHS ester (CAS: 622405-78-1) typically synthesized?

m-PEG4-NHS ester (CAS: 622405-78-1) is synthesized by reacting polyethylene glycol (PEG) with N-hydr...

Compound Q&A

What precautions should be taken when handling m-PEG4-NHS ester (CAS: 622405-78-1)?

When handling m-PEG4-NHS ester (CAS: 622405-78-1), it is crucial to use appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...