Compound Q&A

How is m-PEG4-NHS ester (CAS: 622405-78-1) typically synthesized?

Answer

m-PEG4-NHS ester
m-PEG4-NHS ester (CAS: 622405-78-1) is synthesized by reacting polyethylene glycol (PEG) with N-hydroxysuccinimide (NHS) ester. The reaction is typically catalyzed by a carbodiimide such as EDC (1-ethyl-3-(3-dimethylaminopropyl)carbodiimide). The reaction yields a high degree of selectivity and provides a clean product with high yield. The process is often carried out in a solvent such as DCM (dichloromethane) or DMF (dimethylformamide).

About

English Name m-PEG4-NHS ester
Molecular Formula C14H23NO8
Molecular Weight 333.34 g/mol
SMILES COCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O
InChIKey MAYFFZZPEREGBQ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of m-PEG4-NHS ester (CAS: 622405-78-1)?

m-PEG4-NHS ester (CAS: 622405-78-1) is a water-soluble compound with a molecular weight of approxima...

Compound Q&A

What industries use m-PEG4-NHS ester (CAS: 622405-78-1)?

m-PEG4-NHS ester (CAS: 622405-78-1) is widely used in pharmaceuticals for drug conjugation and drug ...

Compound Q&A

What precautions should be taken when handling m-PEG4-NHS ester (CAS: 622405-78-1)?

When handling m-PEG4-NHS ester (CAS: 622405-78-1), it is crucial to use appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...