Compound Q&A

What are the physical and chemical properties of 2-Bromo-4'-chloro-1,1'-biphenyl (CAS: 179526-95-5)?

Answer

2-Bromo-4'-chloro-1,1'-biphenyl
2-Bromo-4'-chloro-1,1'-biphenyl is a crystalline solid with a molecular weight of approximately 256.03 g/mol. It is slightly soluble in common organic solvents such as chloroform and dichloromethane. Reactivity is moderate, typically requiring heating or the presence of a catalyst for transformations. It is less reactive towards nucleophiles compared to bromine substituents but can undergo substitution reactions under specific conditions.

About

English Name 2-Bromo-4'-chloro-1,1'-biphenyl
Molecular Formula C12H8BrCl
Molecular Weight 267.553 g/mol
SMILES C1=CC=C(C(=C1)C2=CC=C(C=C2)Cl)Br
InChIKey WSHZWUXRWQVZQP-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Bromo-4'-chloro-1,1'-biphenyl (CAS: 179526-95-5) typically synthesized?

2-Bromo-4'-chloro-1,1'-biphenyl is commonly synthesized via bromination of 4'-chlorophenylphenyl eth...

Compound Q&A

What industries use 2-Bromo-4'-chloro-1,1'-biphenyl (CAS: 179526-95-5)?

2-Bromo-4'-chloro-1,1'-biphenyl is used in the pharmaceutical industry for the synthesis of certain ...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4'-chloro-1,1'-biphenyl (CAS: 179526-95-5)?

When handling 2-Bromo-4'-chloro-1,1'-biphenyl, it is essential to use appropriate personal protectiv...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...