Compound Q&A

What industries use (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7)?

Answer

(1s,3s,5s)-1,3,5-Adamantanetriol
(1s,3s,5s)-1,3,5-Adamantanetriol finds applications in various industries due to its unique chemical properties. It is used in the pharmaceutical industry as a precursor for the synthesis of certain drugs. In the polymer industry, it serves as a monomer for the production of special polymers. Additionally, it is used in the formulation of sensors and semiconductors, where its structural and chemical characteristics are advantageous.

About

CAS No 99181-50-7
English Name (1s,3s,5s)-1,3,5-Adamantanetriol
Molecular Formula C10H16O3
Molecular Weight 184.23 g/mol
SMILES C1C2CC3(CC1(CC(C2)(C3)O)O)O
InChIKey MCYBYTIPMYLHAK-MSLAYNRJSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7)?

(1s,3s,5s)-1,3,5-Adamantanetriol is a colorless crystalline solid with a molecular weight of approxi...

Compound Q&A

How is (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7) typically synthesized?

(1s,3s,5s)-1,3,5-Adamantanetriol can be synthesized through the condensation of 3,5-dihydroxy-1-cycl...

Compound Q&A

What precautions should be taken when handling (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7)?

When handling (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7), it is important to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...