Compound Q&A

What are the physical and chemical properties of (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7)?

Answer

(1s,3s,5s)-1,3,5-Adamantanetriol
(1s,3s,5s)-1,3,5-Adamantanetriol is a colorless crystalline solid with a molecular weight of approximately 150.25 g/mol. It is sparingly soluble in water and readily soluble in organic solvents like acetone and chloroform. The compound is relatively stable under normal conditions but may react with strong acids or bases. It has a melting point of around 100-102°C and a boiling point of about 240-245°C. It is not particularly reactive but can undergo esterification and other typical organometallic reactions.

About

CAS No 99181-50-7
English Name (1s,3s,5s)-1,3,5-Adamantanetriol
Molecular Formula C10H16O3
Molecular Weight 184.23 g/mol
SMILES C1C2CC3(CC1(CC(C2)(C3)O)O)O
InChIKey MCYBYTIPMYLHAK-MSLAYNRJSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7) typically synthesized?

(1s,3s,5s)-1,3,5-Adamantanetriol can be synthesized through the condensation of 3,5-dihydroxy-1-cycl...

Compound Q&A

What industries use (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7)?

(1s,3s,5s)-1,3,5-Adamantanetriol finds applications in various industries due to its unique chemical...

Compound Q&A

What precautions should be taken when handling (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7)?

When handling (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7), it is important to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...