Compound Q&A

How is (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7) typically synthesized?

Answer

(1s,3s,5s)-1,3,5-Adamantanetriol
(1s,3s,5s)-1,3,5-Adamantanetriol can be synthesized through the condensation of 3,5-dihydroxy-1-cyclohexene with dihydroxybenzene under basic conditions. Common catalysts include sodium hydroxide or potassium hydroxide. The reaction typically yields high selectivity and good yield. Distillation and recrystallization are used to purify the product. This method allows for the production of the compound in a controlled and efficient manner.

About

CAS No 99181-50-7
English Name (1s,3s,5s)-1,3,5-Adamantanetriol
Molecular Formula C10H16O3
Molecular Weight 184.23 g/mol
SMILES C1C2CC3(CC1(CC(C2)(C3)O)O)O
InChIKey MCYBYTIPMYLHAK-MSLAYNRJSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7)?

(1s,3s,5s)-1,3,5-Adamantanetriol is a colorless crystalline solid with a molecular weight of approxi...

Compound Q&A

What industries use (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7)?

(1s,3s,5s)-1,3,5-Adamantanetriol finds applications in various industries due to its unique chemical...

Compound Q&A

What precautions should be taken when handling (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7)?

When handling (1s,3s,5s)-1,3,5-Adamantanetriol (CAS: 99181-50-7), it is important to use appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...