Compound Q&A

What precautions should be taken when handling 2,3,4-trifluoro-5-nitrobenzoic acid (CAS: 197520-71-1)?

Answer

2,3,4-trifluoro-5-nitrobenzoic acid
When handling 2,3,4-trifluoro-5-nitrobenzoic acid, it is essential to use proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to prevent inhalation of fumes. In case of a spill, immediately use a spill kit and follow the emergency procedures outlined in the Safety Data Sheet (SDS).

About

English Name 2,3,4-trifluoro-5-nitrobenzoic acid
Molecular Formula C7H2F3NO4
Molecular Weight 221.09 g/mol
SMILES C1=C(C(=C(C(=C1[N+](=O)[O-])F)F)F)C(=O)O
InChIKey BCMIOBTWFPSPJJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,4-trifluoro-5-nitrobenzoic acid (CAS: 197520-71-1)?

2,3,4-Trifluoro-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is 2,3,4-trifluoro-5-nitrobenzoic acid (CAS: 197520-71-1) typically synthesized?

2,3,4-Trifluoro-5-nitrobenzoic acid can be synthesized by the nitration of 2,3,4-trifluorobenzoic ac...

Compound Q&A

What industries use 2,3,4-trifluoro-5-nitrobenzoic acid (CAS: 197520-71-1)?

2,3,4-Trifluoro-5-nitrobenzoic acid finds applications in the pharmaceutical industry for the synthe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...