Compound Q&A

What are the physical and chemical properties of 2,3,4-trifluoro-5-nitrobenzoic acid (CAS: 197520-71-1)?

Answer

2,3,4-trifluoro-5-nitrobenzoic acid
2,3,4-Trifluoro-5-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 236.05 g/mol. It is slightly soluble in water and has a low solubility in organic solvents. The compound is highly reactive towards nucleophiles due to its aromatic nitro group. It exhibits acidic properties, particularly when dissociating in aqueous solutions.

About

English Name 2,3,4-trifluoro-5-nitrobenzoic acid
Molecular Formula C7H2F3NO4
Molecular Weight 221.09 g/mol
SMILES C1=C(C(=C(C(=C1[N+](=O)[O-])F)F)F)C(=O)O
InChIKey BCMIOBTWFPSPJJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2,3,4-trifluoro-5-nitrobenzoic acid (CAS: 197520-71-1) typically synthesized?

2,3,4-Trifluoro-5-nitrobenzoic acid can be synthesized by the nitration of 2,3,4-trifluorobenzoic ac...

Compound Q&A

What industries use 2,3,4-trifluoro-5-nitrobenzoic acid (CAS: 197520-71-1)?

2,3,4-Trifluoro-5-nitrobenzoic acid finds applications in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2,3,4-trifluoro-5-nitrobenzoic acid (CAS: 197520-71-1)?

When handling 2,3,4-trifluoro-5-nitrobenzoic acid, it is essential to use proper personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...