Compound Q&A

What industries use Alisol F (CAS: 155521-45-2)?

Answer

Alisol F
Alisol F finds applications in the pharmaceutical industry as a raw material for drug synthesis. It is also used in polymer science for modifying the properties of resins and plastics. Additionally, it can be incorporated into sensor technologies for detecting specific chemical species and in semiconductor industry as a precursor in the fabrication of certain materials.

About

English Name Alisol F
Molecular Formula C30H48O5
Molecular Weight 488.7 g/mol
SMILES O[C@H]1CC2=C3[C@H](C)C[C@H](O[C@H]3C[C@@]2([C@@]2([C@@H]1[C@@]1(C)CCC(=O)C([C@@H]1CC2)(C)C)C)C)[C@H](C(O)(C)C)O
InChIKey YNKJSQIXVXWFBK-SLGDLKFASA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alisol F (CAS: 155521-45-2)?

Alisol F is typically found as a white to off-white solid. It has a molecular weight of approximatel...

Compound Q&A

How is Alisol F (CAS: 155521-45-2) typically synthesized?

Alisol F is usually synthesized via a multi-step process starting from an appropriate precursor, oft...

Compound Q&A

What precautions should be taken when handling Alisol F (CAS: 155521-45-2)?

When handling Alisol F, it is important to wear appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...