Compound Q&A

How is Alisol F (CAS: 155521-45-2) typically synthesized?

Answer

Alisol F
Alisol F is usually synthesized via a multi-step process starting from an appropriate precursor, often involving hydrogenation of a suitable ketone followed by acylation. The exact synthesis method can vary depending on the starting material, but common catalysts include palladium on carbon and aluminum chloride. The overall yield is generally around 70-80%, with good selectivity towards the desired product.

About

English Name Alisol F
Molecular Formula C30H48O5
Molecular Weight 488.7 g/mol
SMILES O[C@H]1CC2=C3[C@H](C)C[C@H](O[C@H]3C[C@@]2([C@@]2([C@@H]1[C@@]1(C)CCC(=O)C([C@@H]1CC2)(C)C)C)C)[C@H](C(O)(C)C)O
InChIKey YNKJSQIXVXWFBK-SLGDLKFASA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alisol F (CAS: 155521-45-2)?

Alisol F is typically found as a white to off-white solid. It has a molecular weight of approximatel...

Compound Q&A

What industries use Alisol F (CAS: 155521-45-2)?

Alisol F finds applications in the pharmaceutical industry as a raw material for drug synthesis. It ...

Compound Q&A

What precautions should be taken when handling Alisol F (CAS: 155521-45-2)?

When handling Alisol F, it is important to wear appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...