Compound Q&A

What are the physical and chemical properties of Alisol F (CAS: 155521-45-2)?

Answer

Alisol F
Alisol F is typically found as a white to off-white solid. It has a molecular weight of approximately 450 g/mol and a melting point of around 220°C. It is slightly soluble in water but more soluble in organic solvents like methanol and acetone. Chemically, it is less reactive under normal conditions but can undergo hydrogenation and acylation under appropriate conditions.

About

English Name Alisol F
Molecular Formula C30H48O5
Molecular Weight 488.7 g/mol
SMILES O[C@H]1CC2=C3[C@H](C)C[C@H](O[C@H]3C[C@@]2([C@@]2([C@@H]1[C@@]1(C)CCC(=O)C([C@@H]1CC2)(C)C)C)C)[C@H](C(O)(C)C)O
InChIKey YNKJSQIXVXWFBK-SLGDLKFASA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Alisol F (CAS: 155521-45-2) typically synthesized?

Alisol F is usually synthesized via a multi-step process starting from an appropriate precursor, oft...

Compound Q&A

What industries use Alisol F (CAS: 155521-45-2)?

Alisol F finds applications in the pharmaceutical industry as a raw material for drug synthesis. It ...

Compound Q&A

What precautions should be taken when handling Alisol F (CAS: 155521-45-2)?

When handling Alisol F, it is important to wear appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...