Compound Q&A

What industries use Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2)?

Answer

Tert-butyl 3-oxoazepane-1-carboxylate
Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) is primarily used in the pharmaceutical and chemical industries for the synthesis of complex molecules and as a building block for other compounds. It is also used in polymer research for the development of new materials and in the electronics industry for sensors and semiconductors.

About

English Name Tert-butyl 3-oxoazepane-1-carboxylate
Molecular Formula C11H19NO3
Molecular Weight 213.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC(=O)C1
InChIKey HMWANNJNYUPZPN-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2)?

Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) is a white crystalline solid with a molecul...

Compound Q&A

How is Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) typically synthesized?

Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) can be synthesized through a two-step proce...

Compound Q&A

What precautions should be taken when handling Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2)?

When handling Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2), it is important to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...