Compound Q&A

What are the physical and chemical properties of Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2)?

Answer

Tert-butyl 3-oxoazepane-1-carboxylate
Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) is a white crystalline solid with a molecular weight of approximately 210.33 g/mol. It has a low solubility in water but is soluble in organic solvents such as methanol and acetonitrile. This compound is relatively stable under normal conditions but can react with strong bases. It is often used in organic synthesis and pharmaceutical applications.

About

English Name Tert-butyl 3-oxoazepane-1-carboxylate
Molecular Formula C11H19NO3
Molecular Weight 213.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC(=O)C1
InChIKey HMWANNJNYUPZPN-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) typically synthesized?

Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) can be synthesized through a two-step proce...

Compound Q&A

What industries use Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2)?

Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2)?

When handling Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2), it is important to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...