Compound Q&A

How is Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) typically synthesized?

Answer

Tert-butyl 3-oxoazepane-1-carboxylate
Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) can be synthesized through a two-step process involving the formation of a tert-butyl azepanone-1-carboxylate followed by a ring-opening reaction. Commonly used catalysts include Lewis acids, and the reaction is typically carried out in organic solvents at room temperature to achieve a yield of around 70-80%.

About

English Name Tert-butyl 3-oxoazepane-1-carboxylate
Molecular Formula C11H19NO3
Molecular Weight 213.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC(=O)C1
InChIKey HMWANNJNYUPZPN-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2)?

Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) is a white crystalline solid with a molecul...

Compound Q&A

What industries use Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2)?

Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2)?

When handling Tert-butyl 3-oxoazepane-1-carboxylate (CAS: 870842-23-2), it is important to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...