Compound Q&A

What precautions should be taken when handling (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9)?

Answer

(3,4-Diethoxyphenyl)acetic acid
When handling (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Lab work should be conducted in a well-ventilated area or a fume hood to prevent inhalation. Spills should be cleaned up immediately with appropriate absorbents, and the area should be flushed with water. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

CAS No 38464-04-9
English Name (3,4-Diethoxyphenyl)acetic acid
Molecular Formula C12H16O4
Molecular Weight 224.26 g/mol
SMILES CCOC1=C(C=C(C=C1)CC(=O)O)OCC
InChIKey FIKUHWAANCXBGJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9)?

(3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) is a white crystalline solid with a molecular weig...

Compound Q&A

How is (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) typically synthesized?

(3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) is commonly synthesized through the acetylation of...

Compound Q&A

What industries use (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9)?

(3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) is used in various industries. In pharmaceuticals,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...