Compound Q&A

What industries use (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9)?

Answer

(3,4-Diethoxyphenyl)acetic acid
(3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) is used in various industries. In pharmaceuticals, it serves as a starting material for the synthesis of certain drugs. It is also utilized in the production of sensors and semiconductors due to its functional groups that can be used for surface modifications. Additionally, it plays a role in the development of polymer additives and coatings.

About

CAS No 38464-04-9
English Name (3,4-Diethoxyphenyl)acetic acid
Molecular Formula C12H16O4
Molecular Weight 224.26 g/mol
SMILES CCOC1=C(C=C(C=C1)CC(=O)O)OCC
InChIKey FIKUHWAANCXBGJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9)?

(3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) is a white crystalline solid with a molecular weig...

Compound Q&A

How is (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) typically synthesized?

(3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) is commonly synthesized through the acetylation of...

Compound Q&A

What precautions should be taken when handling (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9)?

When handling (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9), it is crucial to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...