Compound Q&A

What are the physical and chemical properties of (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9)?

Answer

(3,4-Diethoxyphenyl)acetic acid
(3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) is a white crystalline solid with a molecular weight of approximately 218.24 g/mol. It has a pKa of about 4.5 and is slightly soluble in water but more soluble in organic solvents. This compound is known for its reactivity towards nucleophiles and its ability to form esters and amides easily.

About

CAS No 38464-04-9
English Name (3,4-Diethoxyphenyl)acetic acid
Molecular Formula C12H16O4
Molecular Weight 224.26 g/mol
SMILES CCOC1=C(C=C(C=C1)CC(=O)O)OCC
InChIKey FIKUHWAANCXBGJ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) typically synthesized?

(3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) is commonly synthesized through the acetylation of...

Compound Q&A

What industries use (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9)?

(3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9) is used in various industries. In pharmaceuticals,...

Compound Q&A

What precautions should be taken when handling (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9)?

When handling (3,4-Diethoxyphenyl)acetic acid (CAS: 38464-04-9), it is crucial to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...