Compound Q&A

Is 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) safe?

Answer

3,7-Diamino-5-phenylphenazin-5-ium chloride
3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) is generally considered safe when handled properly. However, it is important to follow all safety guidelines, including wearing appropriate personal protective equipment (PPE), such as gloves and goggles. This compound should be stored away from heat and direct sunlight, and any spills should be handled carefully according to safety protocols.

About

CAS No 81-93-6
English Name 3,7-Diamino-5-phenylphenazin-5-ium chloride
Molecular Formula C18H15ClN4
Molecular Weight 322.79 g/mol
SMILES [Cl-].NC1=C[CH+]C2=NC3=CC=C(N)C=C3N(C3=CC=CC=C3)C2=C1
InChIKey SOUHUMACVWVDME-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6)?

3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) is a nitrogen-containing organic compound...

Compound Q&A

What are the main uses of 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6)?

3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) is primarily used as an intermediate in t...

Compound Q&A

How should 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) be stored?

3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) should be stored in cool, dry conditions,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...