Compound Q&A

What is 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6)?

Answer

3,7-Diamino-5-phenylphenazin-5-ium chloride
3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) is a nitrogen-containing organic compound. It has a molecular structure comprising a phenazin ring system with two amino groups and a phenyl substituent. This compound is often used as an intermediate in the synthesis of other chemicals and has potential applications in pharmaceuticals and dyes.

About

CAS No 81-93-6
English Name 3,7-Diamino-5-phenylphenazin-5-ium chloride
Molecular Formula C18H15ClN4
Molecular Weight 322.79 g/mol
SMILES [Cl-].NC1=C[CH+]C2=NC3=CC=C(N)C=C3N(C3=CC=CC=C3)C2=C1
InChIKey SOUHUMACVWVDME-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6)?

3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) is primarily used as an intermediate in t...

Compound Q&A

Is 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) safe?

3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) is generally considered safe when handled...

Compound Q&A

How should 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) be stored?

3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) should be stored in cool, dry conditions,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...