Compound Q&A

What are the main uses of 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6)?

Answer

3,7-Diamino-5-phenylphenazin-5-ium chloride
3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) is primarily used as an intermediate in the chemical industry, particularly in the synthesis of other compounds. It also has potential applications in the pharmaceutical sector, where it may contribute to the development of new drugs. Additionally, this compound can be used in the production of certain dyes and pigments.

About

CAS No 81-93-6
English Name 3,7-Diamino-5-phenylphenazin-5-ium chloride
Molecular Formula C18H15ClN4
Molecular Weight 322.79 g/mol
SMILES [Cl-].NC1=C[CH+]C2=NC3=CC=C(N)C=C3N(C3=CC=CC=C3)C2=C1
InChIKey SOUHUMACVWVDME-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6)?

3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) is a nitrogen-containing organic compound...

Compound Q&A

Is 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) safe?

3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) is generally considered safe when handled...

Compound Q&A

How should 3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) be stored?

3,7-Diamino-5-phenylphenazin-5-ium chloride (CAS: 81-93-6) should be stored in cool, dry conditions,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...