Compound Q&A

Is 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8) safe?

Answer

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride
2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride is not inherently hazardous but requires careful handling due to its high reactivity. It is important to follow safety guidelines, including proper通风, and the use of appropriate personal protective equipment (PPE) to minimize exposure and potential hazards.

About

English Name 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C9H6ClF5O3S
Molecular Weight 324.65 g/mol
SMILES FC(F)COc1cccc(c1S(=O)(=O)Cl)C(F)(F)F
InChIKey DTNQLYAGRKNWMQ-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8)?

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8) is a chemical ...

Compound Q&A

What are the main uses of 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8)?

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride is primarily used as an intermedi...

Compound Q&A

How should 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8) be stored?

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride should be stored in a cool, dry p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...