Compound Q&A

What is 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8)?

Answer

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride
2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8) is a chemical compound with the molecular formula C10H6F5O2S. It is a clear, colorless to light yellow liquid with a distinctive odor. This compound is characterized by its high reactivity and stability in organic synthesis.

About

English Name 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C9H6ClF5O3S
Molecular Weight 324.65 g/mol
SMILES FC(F)COc1cccc(c1S(=O)(=O)Cl)C(F)(F)F
InChIKey DTNQLYAGRKNWMQ-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What are the main uses of 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8)?

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride is primarily used as an intermedi...

Compound Q&A

Is 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8) safe?

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride is not inherently hazardous but r...

Compound Q&A

How should 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8) be stored?

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride should be stored in a cool, dry p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...