Compound Q&A

What are the main uses of 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8)?

Answer

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride
2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride is primarily used as an intermediate in the synthesis of pharmaceuticals, particularly for the development of drugs targeting various biological pathways. It is also utilized in the chemical industry for its reactivity in organic transformations.

About

English Name 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C9H6ClF5O3S
Molecular Weight 324.65 g/mol
SMILES FC(F)COc1cccc(c1S(=O)(=O)Cl)C(F)(F)F
InChIKey DTNQLYAGRKNWMQ-UHFFFAOYSA-N
Last Updated: 2025-10-15 20:00

Related Q&A

Compound Q&A

What is 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8)?

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8) is a chemical ...

Compound Q&A

Is 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8) safe?

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride is not inherently hazardous but r...

Compound Q&A

How should 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 865352-01-8) be stored?

2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride should be stored in a cool, dry p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...