Compound Q&A

Is Regaloside B (CAS: 114420-67-6) safe?

Answer

Regaloside B
Regaloside B (CAS: 114420-67-6) is generally considered safe for research and industrial use when handled with standard precautions. However, prolonged skin contact or inhalation of dust may cause irritation. Protective gloves and lab coats are recommended to avoid exposure.

About

English Name Regaloside B
Molecular Formula C20H26O11
Molecular Weight 442.4 g/mol
SMILES CC(=O)OCC(COC(=O)C=CC1=CC=C(C=C1)O)OC2C(C(C(C(O2)CO)O)O)O
InChIKey YQKQOLPNKNHLBO-KRJCNZRASA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is Regaloside B (CAS: 114420-67-6)?

Regaloside B (CAS: 114420-67-6) is a triterpenoid saponin found in various plants, particularly in t...

Compound Q&A

What are the main uses of Regaloside B (CAS: 114420-67-6)?

Regaloside B (CAS: 114420-67-6) is primarily used in pharmaceutical research for its potential thera...

Compound Q&A

How should Regaloside B (CAS: 114420-67-6) be stored?

Regaloside B (CAS: 114420-67-6) should be stored in a cool, dry place away from direct sunlight and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...