Compound Q&A

What are the main uses of Regaloside B (CAS: 114420-67-6)?

Answer

Regaloside B
Regaloside B (CAS: 114420-67-6) is primarily used in pharmaceutical research for its potential therapeutic effects in treating inflammatory diseases and cancers. It is also of interest in the food industry for its antioxidant properties and as a natural food additive.

About

English Name Regaloside B
Molecular Formula C20H26O11
Molecular Weight 442.4 g/mol
SMILES CC(=O)OCC(COC(=O)C=CC1=CC=C(C=C1)O)OC2C(C(C(C(O2)CO)O)O)O
InChIKey YQKQOLPNKNHLBO-KRJCNZRASA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What is Regaloside B (CAS: 114420-67-6)?

Regaloside B (CAS: 114420-67-6) is a triterpenoid saponin found in various plants, particularly in t...

Compound Q&A

Is Regaloside B (CAS: 114420-67-6) safe?

Regaloside B (CAS: 114420-67-6) is generally considered safe for research and industrial use when ha...

Compound Q&A

How should Regaloside B (CAS: 114420-67-6) be stored?

Regaloside B (CAS: 114420-67-6) should be stored in a cool, dry place away from direct sunlight and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...