Compound Q&A

What is Regaloside B (CAS: 114420-67-6)?

Answer

Regaloside B
Regaloside B (CAS: 114420-67-6) is a triterpenoid saponin found in various plants, particularly in the genus Regalosia. It has a complex chemical structure including a pentacyclic triterpene backbone and a sugar moiety. Regaloside B is water-soluble and exhibits antioxidant and anti-inflammatory properties.

About

English Name Regaloside B
Molecular Formula C20H26O11
Molecular Weight 442.4 g/mol
SMILES CC(=O)OCC(COC(=O)C=CC1=CC=C(C=C1)O)OC2C(C(C(C(O2)CO)O)O)O
InChIKey YQKQOLPNKNHLBO-KRJCNZRASA-N
Last Updated: 2025-10-15 15:53

Related Q&A

Compound Q&A

What are the main uses of Regaloside B (CAS: 114420-67-6)?

Regaloside B (CAS: 114420-67-6) is primarily used in pharmaceutical research for its potential thera...

Compound Q&A

Is Regaloside B (CAS: 114420-67-6) safe?

Regaloside B (CAS: 114420-67-6) is generally considered safe for research and industrial use when ha...

Compound Q&A

How should Regaloside B (CAS: 114420-67-6) be stored?

Regaloside B (CAS: 114420-67-6) should be stored in a cool, dry place away from direct sunlight and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...