Compound Q&A

What industries use Calcium hydrogen (2S)-2-2-aminosuccinate (1:2:2) (CAS: 39162-75-9)?

Answer

Calcium hydrogen (2S)-2-aminosuccinate (1:2:2)
Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) is primarily used in the pharmaceutical industry due to its potential as a chelating agent and as a precursor for other pharmaceutical compounds. It is also utilized in the polymer industry for its ability to improve the properties of polymers. Additionally, it has applications in sensors and semiconductors for its unique chemical properties.

About

CAS No 39162-75-9
English Name Calcium hydrogen (2S)-2-aminosuccinate (1:2:2)
Molecular Formula C8H12CaN2O8
Molecular Weight 304.27 g/mol
SMILES C(C(C(=O)[O-])N)C(=O)O.C(C(C(=O)[O-])N)C(=O)O.[Ca+2]
InChIKey VAFAEQCKZBKRLZ-CEOVSRFSSA-L
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9)?

Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) is a white crystalline solid with a...

Compound Q&A

How is Calcium hydrogen (2S)-2-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) typically synthesized?

Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) can be synthesized by reacting calc...

Compound Q&A

What precautions should be taken when handling Calcium hydrogen (2S)-2-2-aminosuccinate (1:2:2) (CAS: 39162-75-9)?

When handling Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...