Compound Q&A

How is Calcium hydrogen (2S)-2-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) typically synthesized?

Answer

Calcium hydrogen (2S)-2-aminosuccinate (1:2:2)
Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) can be synthesized by reacting calcium hydrogen succinate with (2S)-2-aminosuccinic acid in a 1:2 molar ratio. The reaction is typically conducted in water at a neutral pH, using mild conditions to ensure high selectivity and yield. Catalysts such as sodium bicarbonate can be used to enhance the reaction efficiency.

About

CAS No 39162-75-9
English Name Calcium hydrogen (2S)-2-aminosuccinate (1:2:2)
Molecular Formula C8H12CaN2O8
Molecular Weight 304.27 g/mol
SMILES C(C(C(=O)[O-])N)C(=O)O.C(C(C(=O)[O-])N)C(=O)O.[Ca+2]
InChIKey VAFAEQCKZBKRLZ-CEOVSRFSSA-L
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9)?

Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) is a white crystalline solid with a...

Compound Q&A

What industries use Calcium hydrogen (2S)-2-2-aminosuccinate (1:2:2) (CAS: 39162-75-9)?

Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Calcium hydrogen (2S)-2-2-aminosuccinate (1:2:2) (CAS: 39162-75-9)?

When handling Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...