Compound Q&A

What are the physical and chemical properties of Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9)?

Answer

Calcium hydrogen (2S)-2-aminosuccinate (1:2:2)
Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) is a white crystalline solid with a molecular weight of approximately 296.3 g/mol. It is slightly soluble in water and ethanol. This compound is known for its reducing properties and can react with various metal ions and oxidizing agents. It is also stable under normal conditions but may decompose at high temperatures.

About

CAS No 39162-75-9
English Name Calcium hydrogen (2S)-2-aminosuccinate (1:2:2)
Molecular Formula C8H12CaN2O8
Molecular Weight 304.27 g/mol
SMILES C(C(C(=O)[O-])N)C(=O)O.C(C(C(=O)[O-])N)C(=O)O.[Ca+2]
InChIKey VAFAEQCKZBKRLZ-CEOVSRFSSA-L
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is Calcium hydrogen (2S)-2-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) typically synthesized?

Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) can be synthesized by reacting calc...

Compound Q&A

What industries use Calcium hydrogen (2S)-2-2-aminosuccinate (1:2:2) (CAS: 39162-75-9)?

Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Calcium hydrogen (2S)-2-2-aminosuccinate (1:2:2) (CAS: 39162-75-9)?

When handling Calcium hydrogen (2S)-2-aminosuccinate (1:2:2) (CAS: 39162-75-9), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...