Compound Q&A

What industries use Pibrentasvir (CAS: 1353900-92-1)?

Answer

Pibrentasvir
Pibrentasvir is primarily used in the pharmaceutical industry for the treatment of hepatitis C virus infections. It is also being explored for potential applications in other fields such as polymer science and materials science, though its main commercial use is in drug development.

About

English Name Pibrentasvir
Molecular Formula C57H65F5N10O8
Molecular Weight 1113.2 g/mol
SMILES C[C@H]([C@@H](C(=O)N1CCC[C@H]1c2[nH]c3cc(c(cc3n2)[C@H]4CC[C@@H](N4c5cc(c(c(c5)F)N6CCC(CC6)c7ccc(cc7)F)F)c8cc9c(cc8F)[nH]c(n9)[C@@H]1CCCN1C(=O)[C@H]([C@@H](C)OC)NC(=O)OC)F)NC(=O)OC)OC
InChIKey VJYSBPDEJWLKKJ-NLIMODCCSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pibrentasvir (CAS: 1353900-92-1)?

Pibrentasvir is a crystalline compound with a molecular weight of approximately 498.54 g/mol. It has...

Compound Q&A

How is Pibrentasvir (CAS: 1353900-92-1) typically synthesized?

Pibrentasvir is typically synthesized through a multi-step organic synthesis process. The key steps ...

Compound Q&A

What precautions should be taken when handling Pibrentasvir (CAS: 1353900-92-1)?

When handling Pibrentasvir, it is crucial to use personal protective equipment (PPE) such as gloves,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...