Compound Q&A

What are the physical and chemical properties of Pibrentasvir (CAS: 1353900-92-1)?

Answer

Pibrentasvir
Pibrentasvir is a crystalline compound with a molecular weight of approximately 498.54 g/mol. It has a solubility of about 0.1 mg/mL in water. Chemically, it is not highly reactive under normal conditions but can undergo oxidation under acidic or alkaline conditions. Its melting point is around 220-225°C.

About

English Name Pibrentasvir
Molecular Formula C57H65F5N10O8
Molecular Weight 1113.2 g/mol
SMILES C[C@H]([C@@H](C(=O)N1CCC[C@H]1c2[nH]c3cc(c(cc3n2)[C@H]4CC[C@@H](N4c5cc(c(c(c5)F)N6CCC(CC6)c7ccc(cc7)F)F)c8cc9c(cc8F)[nH]c(n9)[C@@H]1CCCN1C(=O)[C@H]([C@@H](C)OC)NC(=O)OC)F)NC(=O)OC)OC
InChIKey VJYSBPDEJWLKKJ-NLIMODCCSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

How is Pibrentasvir (CAS: 1353900-92-1) typically synthesized?

Pibrentasvir is typically synthesized through a multi-step organic synthesis process. The key steps ...

Compound Q&A

What industries use Pibrentasvir (CAS: 1353900-92-1)?

Pibrentasvir is primarily used in the pharmaceutical industry for the treatment of hepatitis C virus...

Compound Q&A

What precautions should be taken when handling Pibrentasvir (CAS: 1353900-92-1)?

When handling Pibrentasvir, it is crucial to use personal protective equipment (PPE) such as gloves,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...