Compound Q&A

How is Pibrentasvir (CAS: 1353900-92-1) typically synthesized?

Answer

Pibrentasvir
Pibrentasvir is typically synthesized through a multi-step organic synthesis process. The key steps involve protecting group chemistry, coupling reactions, and ring formation. The synthesis is carried out using standard organic solvents and catalysts. The overall yield is around 60% to 70%.

About

English Name Pibrentasvir
Molecular Formula C57H65F5N10O8
Molecular Weight 1113.2 g/mol
SMILES C[C@H]([C@@H](C(=O)N1CCC[C@H]1c2[nH]c3cc(c(cc3n2)[C@H]4CC[C@@H](N4c5cc(c(c(c5)F)N6CCC(CC6)c7ccc(cc7)F)F)c8cc9c(cc8F)[nH]c(n9)[C@@H]1CCCN1C(=O)[C@H]([C@@H](C)OC)NC(=O)OC)F)NC(=O)OC)OC
InChIKey VJYSBPDEJWLKKJ-NLIMODCCSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pibrentasvir (CAS: 1353900-92-1)?

Pibrentasvir is a crystalline compound with a molecular weight of approximately 498.54 g/mol. It has...

Compound Q&A

What industries use Pibrentasvir (CAS: 1353900-92-1)?

Pibrentasvir is primarily used in the pharmaceutical industry for the treatment of hepatitis C virus...

Compound Q&A

What precautions should be taken when handling Pibrentasvir (CAS: 1353900-92-1)?

When handling Pibrentasvir, it is crucial to use personal protective equipment (PPE) such as gloves,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...