Compound Q&A

What precautions should be taken when handling DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9)?

Answer

DMT-2'O-Methyl-rU Phosphoramidite
When handling DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9), it is essential to use appropriate personal protective equipment (PPE) such as gloves, safety glasses, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize inhalation risks. Spills should be cleaned up immediately using absorbent materials and followed by thorough decontamination. Always refer to the safety data sheet (SDS) for specific handling and disposal instructions.

About

English Name DMT-2'O-Methyl-rU Phosphoramidite
Molecular Formula C40H49N4O9P
Molecular Weight 17.03 g/mol
SMILES CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OC)N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9)?

DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9) is a white to off-white solid with a molecular ...

Compound Q&A

How is DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9) typically synthesized?

DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9) is typically synthesized through the methylatio...

Compound Q&A

What industries use DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9)?

DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9) is primarily used in the pharmaceutical industr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...