Compound Q&A

How is DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9) typically synthesized?

Answer

DMT-2'O-Methyl-rU Phosphoramidite
DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9) is typically synthesized through the methylation of 2'-O-methyl-uridine followed by phosphoramidite formation. This process involves the use of methylating agents like methyl triflate and a catalyst such as 4-(dimethylamino)pyridine (DMAP). The yield is usually high, and the product is isolated by purification techniques like column chromatography.

About

English Name DMT-2'O-Methyl-rU Phosphoramidite
Molecular Formula C40H49N4O9P
Molecular Weight 17.03 g/mol
SMILES CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OC)N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC
InChIKey QGZKDVFQNNGYKY-UHFFFAOYSA-N
Last Updated: 2025-10-13 19:39

Related Q&A

Compound Q&A

What are the physical and chemical properties of DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9)?

DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9) is a white to off-white solid with a molecular ...

Compound Q&A

What industries use DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9)?

DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9) is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9)?

When handling DMT-2'O-Methyl-rU Phosphoramidite (CAS: 110764-79-9), it is essential to use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...