Compound Q&A

What industries use 1-Fluoro-2-methoxy-4-nitrobenzene (CAS: 454-16-0)?

Answer

1-Fluoro-2-methoxy-4-nitrobenzene
1-Fluoro-2-methoxy-4-nitrobenzene is primarily used in the pharmaceutical industry for the synthesis of intermediate compounds. It also finds applications in the development of sensors and certain polymers due to its functional groups and reactivity.

About

CAS No 454-16-0
English Name 1-Fluoro-2-methoxy-4-nitrobenzene
Molecular Formula C7H6FNO3
Molecular Weight 171.13 g/mol
SMILES COC1=C(C=CC(=C1)[N+](=O)[O-])F
InChIKey AZNKKZHZGDZSIF-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-methoxy-4-nitrobenzene (CAS: 454-16-0)?

1-Fluoro-2-methoxy-4-nitrobenzene has a crystalline form and a molecular weight of 225.06 g/mol. It ...

Compound Q&A

How is 1-Fluoro-2-methoxy-4-nitrobenzene (CAS: 454-16-0) typically synthesized?

1-Fluoro-2-methoxy-4-nitrobenzene is commonly synthesized via the nitration of 2-methoxybenzene foll...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-methoxy-4-nitrobenzene (CAS: 454-16-0)?

Handling 1-Fluoro-2-methoxy-4-nitrobenzene requires the use of personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...