Compound Q&A

What are the physical and chemical properties of 1-Fluoro-2-methoxy-4-nitrobenzene (CAS: 454-16-0)?

Answer

1-Fluoro-2-methoxy-4-nitrobenzene
1-Fluoro-2-methoxy-4-nitrobenzene has a crystalline form and a molecular weight of 225.06 g/mol. It is slightly soluble in water but miscible with organic solvents. This compound is known for its reactivity, particularly in nucleophilic substitution and reduction reactions.

About

CAS No 454-16-0
English Name 1-Fluoro-2-methoxy-4-nitrobenzene
Molecular Formula C7H6FNO3
Molecular Weight 171.13 g/mol
SMILES COC1=C(C=CC(=C1)[N+](=O)[O-])F
InChIKey AZNKKZHZGDZSIF-UHFFFAOYSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is 1-Fluoro-2-methoxy-4-nitrobenzene (CAS: 454-16-0) typically synthesized?

1-Fluoro-2-methoxy-4-nitrobenzene is commonly synthesized via the nitration of 2-methoxybenzene foll...

Compound Q&A

What industries use 1-Fluoro-2-methoxy-4-nitrobenzene (CAS: 454-16-0)?

1-Fluoro-2-methoxy-4-nitrobenzene is primarily used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-2-methoxy-4-nitrobenzene (CAS: 454-16-0)?

Handling 1-Fluoro-2-methoxy-4-nitrobenzene requires the use of personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...