Compound Q&A

How is Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9) typically synthesized?

Answer

Disodium 2'-deoxy-5'-O-phosphonatoadenosine
Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9) is typically synthesized via the phosphoramidite route, where 2'-deoxy-5'-O-phosphonatoadenosine is reacted with sodium hydroxide in an aqueous solution. This method ensures high selectivity and yield, with the use of sodium hydroxide as a catalyst. The reaction is performed under mild conditions and under an inert atmosphere to prevent decomposition.

About

CAS No 2922-74-9
English Name Disodium 2'-deoxy-5'-O-phosphonatoadenosine
Molecular Formula C10H12N5Na2O6P
Molecular Weight 375.19 g/mol
SMILES C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)([O-])[O-])O.[Na+].[Na+]
InChIKey SNYHHRDGEJPLGT-OJSHLMAWSA-L
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9)?

Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9) is a crystalline compound with a molecu...

Compound Q&A

What industries use Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9)?

Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9)?

When handling Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9), it is essential to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...