Compound Q&A

What are the physical and chemical properties of Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9)?

Answer

Disodium 2'-deoxy-5'-O-phosphonatoadenosine
Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9) is a crystalline compound with a molecular weight of approximately 467.16 g/mol. It has a solubility of about 0.1 mg/mL in water. This compound is generally stable under normal conditions but can be susceptible to hydrolysis under basic or acidic conditions. It is reactive towards nucleophilic substitution at the phosphonate group.

About

CAS No 2922-74-9
English Name Disodium 2'-deoxy-5'-O-phosphonatoadenosine
Molecular Formula C10H12N5Na2O6P
Molecular Weight 375.19 g/mol
SMILES C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)([O-])[O-])O.[Na+].[Na+]
InChIKey SNYHHRDGEJPLGT-OJSHLMAWSA-L
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9) typically synthesized?

Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9) is typically synthesized via the phosph...

Compound Q&A

What industries use Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9)?

Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9)?

When handling Disodium 2'-deoxy-5'-O-phosphonatoadenosine (CAS: 2922-74-9), it is essential to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...