Compound Q&A

What industries use Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2)?

Answer

Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate
Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate finds applications in the pharmaceutical industry for its potential as a chelating agent and in the semiconductor industry for its role in masking and etching processes. It is also used in the polymer industry for stabilizing and modifying materials.

About

CAS No 20592-85-2
English Name Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate
Molecular Formula C3H11NNaO9P3
Molecular Weight 321.03 g/mol
SMILES C(N(CP(=O)(O)O)CP(=O)(O)[O-])P(=O)(O)O.[Na+]
InChIKey RCUMDGGJOOTRBS-UHFFFAOYSA-M
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2)?

Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate is a crystalline compound with a mole...

Compound Q&A

How is Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2) typically synthesized?

Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate is synthesized from phosphonic acid d...

Compound Q&A

What precautions should be taken when handling Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2)?

When handling Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...