Compound Q&A

How is Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2) typically synthesized?

Answer

Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate
Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate is synthesized from phosphonic acid derivatives and amines. The reaction involves the use of a catalyst, such as a tertiary amine, to promote the reaction. The yield is typically between 70-80%, with high selectivity for the desired product. Detailed synthesis procedures can be found in relevant literature.

About

CAS No 20592-85-2
English Name Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate
Molecular Formula C3H11NNaO9P3
Molecular Weight 321.03 g/mol
SMILES C(N(CP(=O)(O)O)CP(=O)(O)[O-])P(=O)(O)O.[Na+]
InChIKey RCUMDGGJOOTRBS-UHFFFAOYSA-M
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2)?

Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate is a crystalline compound with a mole...

Compound Q&A

What industries use Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2)?

Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate finds applications in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2)?

When handling Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...