Compound Q&A

What are the physical and chemical properties of Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2)?

Answer

Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate
Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate is a crystalline compound with a molecular weight of approximately 269.13 g/mol. It has a high solubility in water and is slightly soluble in ethanol. This compound is relatively stable under normal conditions but can react with strong acids. It is an organophosphonate with potential reactivity towards nucleophiles.

About

CAS No 20592-85-2
English Name Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate
Molecular Formula C3H11NNaO9P3
Molecular Weight 321.03 g/mol
SMILES C(N(CP(=O)(O)O)CP(=O)(O)[O-])P(=O)(O)O.[Na+]
InChIKey RCUMDGGJOOTRBS-UHFFFAOYSA-M
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

How is Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2) typically synthesized?

Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate is synthesized from phosphonic acid d...

Compound Q&A

What industries use Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2)?

Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate finds applications in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate (CAS: 20592-85-2)?

When handling Sodium hydrogen {[bis(phosphonomethyl)amino]methyl}phosphonate, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...