Compound Q&A

What precautions should be taken when handling (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (CAS: 144750-42-5)?

Answer

(2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (1:1)
When handling this compound, appropriate personal protective equipment (PPE) such as gloves and safety glasses should be worn. It should be stored in a fume hood and away from strong acids and bases. In case of a spill, it should be handled carefully and possibly neutralized with a suitable base before disposal. Always refer to the Safety Data Sheet (SDS) for detailed handling and safety guidelines.

About

English Name (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (1:1)
Molecular Formula C15H15Cl2NO2S
Molecular Weight 344.26 g/mol
SMILES c1ccc(c(c1)[C@@H](C(=O)O)N2CCc3c(ccs3)C2)Cl.Cl
InChIKey FOKSIOUPGDBSLC-UQKRIMTDSA-N
Last Updated: 2025-10-13 17:50

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (CAS: 144750-42-5)?

This compound has a crystalline form and a molecular weight of approximately 395.73 g/mol. It is spa...

Compound Q&A

How is (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (CAS: 144750-42-5) typically synthesized?

The compound is typically synthesized via a multi-step process involving the reaction of a 2-chlorop...

Compound Q&A

What industries use (2S)-(2-Chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetic acid hydrochloride (CAS: 144750-42-5)?

This compound is used in the pharmaceutical industry for its potential as a drug candidate. It is al...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...